C24H21N7O2 — CID 139976250
3-[[[6-anilino-2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]phenol (PubChem CID 139976250) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-[[[6-anilino-2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 3-[[[6-anilino-2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 139976250 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[[[6-anilino-2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1cccc(C=NNc2cc(Nc3ccccc3)nc(NN=Cc3cccc(O)c3)n2)c1 |
| InChI | InChI=1S/C24H21N7O2/c32-20-10-4-6-17(12-20)15-25-30-23-14-22(27-19-8-2-1-3-9-19)28-24(29-23)31-26-16-18-7-5-11-21(33)13-18/h1-16,32-33H,(H3,27,28,29,30,31) |
| InChIKey | FTSLKZPKECISDW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|