C26H19F6N7 — CID 139976380
6-N-phenyl-2-N,4-N-bis[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976380) has the molecular formula C26H19F6N7 and a molecular weight of 543.48 g/mol. Its IUPAC name is 6-N-phenyl-2-N,4-N-bis[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-phenyl-2-N,4-N-bis[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976380 |
| Molecular Formula | C26H19F6N7 |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 6-N-phenyl-2-N,4-N-bis[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | FC(F)(F)c1ccccc1C=NNc1cc(Nc2ccccc2)nc(NN=Cc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C26H19F6N7/c27-25(28,29)20-12-6-4-8-17(20)15-33-38-23-14-22(35-19-10-2-1-3-11-19)36-24(37-23)39-34-16-18-9-5-7-13-21(18)26(30,31)32/h1-16H,(H3,35,36,37,38,39) |
| InChIKey | ARAORLHZUREQEG-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|