C28H29N7O2 — CID 139976192
4-[[[6-anilino-2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol (PubChem CID 139976192) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-[[[6-anilino-2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol.
| Compound Name | 4-[[[6-anilino-2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 139976192 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 4-[[[6-anilino-2-[2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]hydrazinylidene]methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C=NNc2cc(Nc3ccccc3)nc(NN=Cc3cc(C)c(O)c(C)c3)n2)cc(C)c1O |
| InChI | InChI=1S/C28H29N7O2/c1-17-10-21(11-18(2)26(17)36)15-29-34-25-14-24(31-23-8-6-5-7-9-23)32-28(33-25)35-30-16-22-12-19(3)27(37)20(4)13-22/h5-16,36-37H,1-4H3,(H3,31,32,33,34,35) |
| InChIKey | IPZFACHWMCGFHZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|