C27H27N7O — CID 139976033
6-N-(2-methoxyphenyl)-2-N,4-N-bis[(4-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 139976033) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(4-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(4-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 139976033 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 6-N-(2-methoxyphenyl)-2-N,4-N-bis[(4-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | COc1ccccc1Nc1cc(NN=Cc2ccc(C)cc2)nc(NN=Cc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C27H27N7O/c1-19-8-12-21(13-9-19)17-28-33-26-16-25(30-23-6-4-5-7-24(23)35-3)31-27(32-26)34-29-18-22-14-10-20(2)11-15-22/h4-18H,1-3H3,(H3,30,31,32,33,34) |
| InChIKey | BLEFNKLTMLBJAV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|