C27H29N7O3 — CID 3720446
4-N,6-N-bis(4-methylphenyl)-2-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 3720446) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is 4-N,6-N-bis(4-methylphenyl)-2-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis(4-methylphenyl)-2-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3720446 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 4-N,6-N-bis(4-methylphenyl)-2-N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cc(C=NNc2nc(Nc3ccc(C)cc3)nc(Nc3ccc(C)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H29N7O3/c1-17-6-10-20(11-7-17)29-25-31-26(30-21-12-8-18(2)9-13-21)33-27(32-25)34-28-16-19-14-22(35-3)24(37-5)23(15-19)36-4/h6-16H,1-5H3,(H3,29,30,31,32,33,34) |
| InChIKey | KQQKBJZUMRLSFR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|