C29H27N7O — CID 171978873
4-N-(2,4-dimethylphenyl)-2-N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 171978873) has the molecular formula C29H27N7O and a molecular weight of 489.58 g/mol. Its IUPAC name is 4-N-(2,4-dimethylphenyl)-2-N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,4-dimethylphenyl)-2-N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171978873 |
| Molecular Formula | C29H27N7O |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 4-N-(2,4-dimethylphenyl)-2-N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2ccccc2c1/C=N\Nc1nc(Nc2ccccc2)nc(Nc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C29H27N7O/c1-19-13-15-25(20(2)17-19)32-28-33-27(31-22-10-5-4-6-11-22)34-29(35-28)36-30-18-24-23-12-8-7-9-21(23)14-16-26(24)37-3/h4-18H,1-3H3,(H3,31,32,33,34,35,36)/b30-18- |
| InChIKey | CKOREHLKOMTGPD-YKQZZPSBSA-N |
| XLogP | 6.58 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|