C19H18N2O2 — CID 126015225
N-[(E)-(2,7-dimethoxynaphthalen-1-yl)methylideneamino]aniline (PubChem CID 126015225) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(E)-(2,7-dimethoxynaphthalen-1-yl)methylideneamino]aniline.
| Compound Name | N-[(E)-(2,7-dimethoxynaphthalen-1-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 126015225 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[(E)-(2,7-dimethoxynaphthalen-1-yl)methylideneamino]aniline |
| SMILES | COc1ccc2ccc(OC)c(/C=N/Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C19H18N2O2/c1-22-16-10-8-14-9-11-19(23-2)18(17(14)12-16)13-20-21-15-6-4-3-5-7-15/h3-13,21H,1-2H3/b20-13+ |
| InChIKey | ZAFBKMBWDCSSBI-DEDYPNTBSA-N |
| XLogP | 4.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|