C21H18N4O3 — CID 135697091
2-[(2E)-2-[(2,7-dimethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3H-quinazolin-4-one (PubChem CID 135697091) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[(2E)-2-[(2,7-dimethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(2E)-2-[(2,7-dimethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135697091 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[(2E)-2-[(2,7-dimethoxynaphthalen-1-yl)methylidene]hydrazinyl]-3H-quinazolin-4-one |
| SMILES | COc1ccc2ccc(OC)c(/C=N/Nc3nc4ccccc4c(=O)[nH]3)c2c1 |
| InChI | InChI=1S/C21H18N4O3/c1-27-14-9-7-13-8-10-19(28-2)17(16(13)11-14)12-22-25-21-23-18-6-4-3-5-15(18)20(26)24-21/h3-12H,1-2H3,(H2,23,24,25,26)/b22-12+ |
| InChIKey | JEQGLJWLWXDSKU-WSDLNYQXSA-N |
| XLogP | 3.54 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|