C16H19N3O2S — CID 5197013
1-[(2,7-dimethoxynaphthalen-1-yl)methylideneamino]-3-ethylthiourea (PubChem CID 5197013) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[(2,7-dimethoxynaphthalen-1-yl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(2,7-dimethoxynaphthalen-1-yl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 5197013 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[(2,7-dimethoxynaphthalen-1-yl)methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1c(OC)ccc2ccc(OC)cc12 |
| InChI | InChI=1S/C16H19N3O2S/c1-4-17-16(22)19-18-10-14-13-9-12(20-2)7-5-11(13)6-8-15(14)21-3/h5-10H,4H2,1-3H3,(H2,17,19,22) |
| InChIKey | BSIBEEPNYXFAIU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|