C25H24N8O4 — CID 171979304
2-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 171979304) has the molecular formula C25H24N8O4 and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171979304 |
| Molecular Formula | C25H24N8O4 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc2ccccc2c1/C=N/Nc1nc(Nc2ccc([N+](=O)[O-])cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C25H24N8O4/c1-36-22-11-6-17-4-2-3-5-20(17)21(22)16-26-31-24-28-23(27-18-7-9-19(10-8-18)33(34)35)29-25(30-24)32-12-14-37-15-13-32/h2-11,16H,12-15H2,1H3,(H2,27,28,29,30,31)/b26-16+ |
| InChIKey | LWRLNXOVVUKLFE-WGOQTCKBSA-N |
| XLogP | 3.97 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|