C20H19BrN8O3 — CID 56696120
2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 56696120) has the molecular formula C20H19BrN8O3 and a molecular weight of 499.33 g/mol. Its IUPAC name is 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56696120 |
| Molecular Formula | C20H19BrN8O3 |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C/c3cccc(Br)c3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H19BrN8O3/c21-15-3-1-2-14(12-15)13-22-27-19-24-18(23-16-4-6-17(7-5-16)29(30)31)25-20(26-19)28-8-10-32-11-9-28/h1-7,12-13H,8-11H2,(H2,23,24,25,26,27)/b22-13+ |
| InChIKey | GXUMUQOLOURYHM-LPYMAVHISA-N |
| XLogP | 3.57 |
| TPSA | 130.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|