C20H19N9O6 — CID 135637378
2-[(E)-[[4-morpholin-4-yl-6-(3-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 135637378) has the molecular formula C20H19N9O6 and a molecular weight of 481.43 g/mol. Its IUPAC name is 2-[(E)-[[4-morpholin-4-yl-6-(3-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-[(E)-[[4-morpholin-4-yl-6-(3-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135637378 |
| Molecular Formula | C20H19N9O6 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-[(E)-[[4-morpholin-4-yl-6-(3-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(Nc2nc(N/N=C/c3cc([N+](=O)[O-])ccc3O)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C20H19N9O6/c30-17-5-4-16(29(33)34)10-13(17)12-21-26-19-23-18(22-14-2-1-3-15(11-14)28(31)32)24-20(25-19)27-6-8-35-9-7-27/h1-5,10-12,30H,6-9H2,(H2,22,23,24,25,26)/b21-12+ |
| InChIKey | REKLLDABWDSMDW-CIAFOILYSA-N |
| XLogP | 2.42 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|