C21H21BrN8O4 — CID 4989417
4-N-(3-bromophenyl)-2-N-[(2-methoxy-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 4989417) has the molecular formula C21H21BrN8O4 and a molecular weight of 529.36 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-2-N-[(2-methoxy-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-bromophenyl)-2-N-[(2-methoxy-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4989417 |
| Molecular Formula | C21H21BrN8O4 |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 4-N-(3-bromophenyl)-2-N-[(2-methoxy-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=NNc1nc(Nc2cccc(Br)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H21BrN8O4/c1-33-18-6-5-17(30(31)32)11-14(18)13-23-28-20-25-19(24-16-4-2-3-15(22)12-16)26-21(27-20)29-7-9-34-10-8-29/h2-6,11-13H,7-10H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | YDDOTWMHYBPQFN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|