C21H18ClF3N8O3 — CID 5253501
2-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 5253501) has the molecular formula C21H18ClF3N8O3 and a molecular weight of 522.88 g/mol. Its IUPAC name is 2-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5253501 |
| Molecular Formula | C21H18ClF3N8O3 |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 2-N-[(2-chloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C=NNc2nc(Nc3cccc(C(F)(F)F)c3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C21H18ClF3N8O3/c22-17-5-4-16(33(34)35)10-13(17)12-26-31-19-28-18(29-20(30-19)32-6-8-36-9-7-32)27-15-3-1-2-14(11-15)21(23,24)25/h1-5,10-12H,6-9H2,(H2,27,28,29,30,31) |
| InChIKey | CGIOZJRCSSVMKW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 130.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|