C18H15F3N8O3 — CID 5240501
2-[[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 5240501) has the molecular formula C18H15F3N8O3 and a molecular weight of 448.37 g/mol. Its IUPAC name is 2-[[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-[[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 5240501 |
| Molecular Formula | C18H15F3N8O3 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | CNc1nc(NN=Cc2cc([N+](=O)[O-])ccc2O)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H15F3N8O3/c1-22-15-25-16(24-12-4-2-3-11(8-12)18(19,20)21)27-17(26-15)28-23-9-10-7-13(29(31)32)5-6-14(10)30/h2-9,30H,1H3,(H3,22,24,25,26,27,28) |
| InChIKey | VCYJZWQOPUIHQH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|