C22H17FN8O2 — CID 6088818
2-N-[(Z)-(2-fluoro-5-nitrophenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 6088818) has the molecular formula C22H17FN8O2 and a molecular weight of 444.43 g/mol. Its IUPAC name is 2-N-[(Z)-(2-fluoro-5-nitrophenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(Z)-(2-fluoro-5-nitrophenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6088818 |
| Molecular Formula | C22H17FN8O2 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-N-[(Z)-(2-fluoro-5-nitrophenyl)methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | O=[N+]([O-])c1ccc(F)c(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H17FN8O2/c23-19-12-11-18(31(32)33)13-15(19)14-24-30-22-28-20(25-16-7-3-1-4-8-16)27-21(29-22)26-17-9-5-2-6-10-17/h1-14H,(H3,25,26,27,28,29,30)/b24-14- |
| InChIKey | HQDYSDFXVYLGST-OYKKKHCWSA-N |
| XLogP | 4.85 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|