C24H21IN8O2 — CID 3877887
4-N-(3,4-dimethylphenyl)-2-N-[(2-iodophenyl)methylideneamino]-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 3877887) has the molecular formula C24H21IN8O2 and a molecular weight of 580.39 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-2-N-[(2-iodophenyl)methylideneamino]-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(3,4-dimethylphenyl)-2-N-[(2-iodophenyl)methylideneamino]-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3877887 |
| Molecular Formula | C24H21IN8O2 |
| Molecular Weight | 580.39 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-2-N-[(2-iodophenyl)methylideneamino]-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(NN=Cc3ccccc3I)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C24H21IN8O2/c1-15-7-8-19(13-16(15)2)28-23-29-22(27-18-9-11-20(12-10-18)33(34)35)30-24(31-23)32-26-14-17-5-3-4-6-21(17)25/h3-14H,1-2H3,(H3,27,28,29,30,31,32) |
| InChIKey | PTYQVYFMCKVHFI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|