C23H21N9O2 — CID 6229337
4-N-(3,4-dimethylphenyl)-6-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 6229337) has the molecular formula C23H21N9O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-6-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(3,4-dimethylphenyl)-6-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 6229337 |
| Molecular Formula | C23H21N9O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-6-N-(4-nitrophenyl)-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C\c3ccncc3)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C23H21N9O2/c1-15-3-4-19(13-16(15)2)27-22-28-21(26-18-5-7-20(8-6-18)32(33)34)29-23(30-22)31-25-14-17-9-11-24-12-10-17/h3-14H,1-2H3,(H3,26,27,28,29,30,31)/b25-14- |
| InChIKey | JEXINCTVQRQZJA-QFEZKATASA-N |
| XLogP | 4.72 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|