C25H25N9O2 — CID 4668408
2-N-[[4-(dimethylamino)phenyl]methylideneamino]-4-N-(2-methylphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 4668408) has the molecular formula C25H25N9O2 and a molecular weight of 483.54 g/mol. Its IUPAC name is 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-4-N-(2-methylphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-4-N-(2-methylphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 4668408 |
| Molecular Formula | C25H25N9O2 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-N-[[4-(dimethylamino)phenyl]methylideneamino]-4-N-(2-methylphenyl)-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccccc1Nc1nc(NN=Cc2ccc(N(C)C)cc2)nc(Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C25H25N9O2/c1-17-6-4-5-7-22(17)28-24-29-23(27-19-10-14-21(15-11-19)34(35)36)30-25(31-24)32-26-16-18-8-12-20(13-9-18)33(2)3/h4-16H,1-3H3,(H3,27,28,29,30,31,32) |
| InChIKey | RGOFQHKLKONITN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|