C23H19N9O5 — CID 3914765
4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-2-N-[(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 3914765) has the molecular formula C23H19N9O5 and a molecular weight of 501.46 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-2-N-[(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-2-N-[(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3914765 |
| Molecular Formula | C23H19N9O5 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-6-N-(4-nitrophenyl)-2-N-[(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(NN=Cc3ccc([N+](=O)[O-])cc3)nc(Nc3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C23H19N9O5/c1-37-20-12-6-17(7-13-20)26-22-27-21(25-16-4-10-19(11-5-16)32(35)36)28-23(29-22)30-24-14-15-2-8-18(9-3-15)31(33)34/h2-14H,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | DXWSMKWPMFYBBC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|