C13H13N5O2 — CID 1420807
4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]pyrimidin-2-amine (PubChem CID 1420807) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 1420807 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NN=Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C13H13N5O2/c1-9-7-10(2)16-13(15-9)17-14-8-11-3-5-12(6-4-11)18(19)20/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | DHLTVCOJWRVFQV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|