C15H13N5O3 — CID 2835949
4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]furo[2,3-d]pyrimidin-2-amine (PubChem CID 2835949) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]furo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]furo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 2835949 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4,6-dimethyl-N-[(4-nitrophenyl)methylideneamino]furo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc2c(C)nc(NN=Cc3ccc([N+](=O)[O-])cc3)nc2o1 |
| InChI | InChI=1S/C15H13N5O3/c1-9-7-13-10(2)17-15(18-14(13)23-9)19-16-8-11-3-5-12(6-4-11)20(21)22/h3-8H,1-2H3,(H,17,18,19) |
| InChIKey | SLRRUDVQDNZVBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|