C21H19N3O3 — CID 110842153
N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]-4-nitroaniline (PubChem CID 110842153) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 110842153 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]-4-nitroaniline |
| SMILES | Cc1ccc(Oc2ccc(C=NNc3ccc([N+](=O)[O-])cc3)cc2)cc1C |
| InChI | InChI=1S/C21H19N3O3/c1-15-3-10-21(13-16(15)2)27-20-11-4-17(5-12-20)14-22-23-18-6-8-19(9-7-18)24(25)26/h3-14,23H,1-2H3 |
| InChIKey | GHRNOHUMPHBAEZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|