C21H18Cl2N2O — CID 110840617
3,4-dichloro-N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]aniline (PubChem CID 110840617) has the molecular formula C21H18Cl2N2O and a molecular weight of 385.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110840617 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3,4-dichloro-N-[[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]aniline |
| SMILES | Cc1ccc(Oc2ccc(C=NNc3ccc(Cl)c(Cl)c3)cc2)cc1C |
| InChI | InChI=1S/C21H18Cl2N2O/c1-14-3-7-19(11-15(14)2)26-18-8-4-16(5-9-18)13-24-25-17-6-10-20(22)21(23)12-17/h3-13,25H,1-2H3 |
| InChIKey | GTXLIDIGTGRQTA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|