C17H20N2 — CID 110505055
N-[(E)-(4-ethylphenyl)methylideneamino]-3,4-dimethylaniline (PubChem CID 110505055) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[(E)-(4-ethylphenyl)methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[(E)-(4-ethylphenyl)methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110505055 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[(E)-(4-ethylphenyl)methylideneamino]-3,4-dimethylaniline |
| SMILES | CCc1ccc(/C=N/Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-4-15-6-8-16(9-7-15)12-18-19-17-10-5-13(2)14(3)11-17/h5-12,19H,4H2,1-3H3/b18-12+ |
| InChIKey | JRWXRUVSCAJSJY-LDADJPATSA-N |
| XLogP | 4.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|