C12H12N6O4 — CID 3774421
1,5-dimethyl-4-nitro-N-[(4-nitrophenyl)methylideneamino]pyrazol-3-amine (PubChem CID 3774421) has the molecular formula C12H12N6O4 and a molecular weight of 304.27 g/mol. Its IUPAC name is 1,5-dimethyl-4-nitro-N-[(4-nitrophenyl)methylideneamino]pyrazol-3-amine.
| Compound Name | 1,5-dimethyl-4-nitro-N-[(4-nitrophenyl)methylideneamino]pyrazol-3-amine |
|---|---|
| PubChem CID | 3774421 |
| Molecular Formula | C12H12N6O4 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1,5-dimethyl-4-nitro-N-[(4-nitrophenyl)methylideneamino]pyrazol-3-amine |
| SMILES | Cc1c([N+](=O)[O-])c(NN=Cc2ccc([N+](=O)[O-])cc2)nn1C |
| InChI | InChI=1S/C12H12N6O4/c1-8-11(18(21)22)12(15-16(8)2)14-13-7-9-3-5-10(6-4-9)17(19)20/h3-7H,1-2H3,(H,14,15) |
| InChIKey | ITCPGBRKJXBRSA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|