C22H17N9O5 — CID 135637772
2-[(E)-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 135637772) has the molecular formula C22H17N9O5 and a molecular weight of 487.44 g/mol. Its IUPAC name is 2-[(E)-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-[(E)-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135637772 |
| Molecular Formula | C22H17N9O5 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[(E)-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C/c3cc([N+](=O)[O-])ccc3O)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H17N9O5/c32-19-11-10-18(31(35)36)12-14(19)13-23-29-22-27-20(24-15-4-2-1-3-5-15)26-21(28-22)25-16-6-8-17(9-7-16)30(33)34/h1-13,32H,(H3,24,25,26,27,28,29)/b23-13+ |
| InChIKey | DGVHNBILEMBZOX-YDZHTSKRSA-N |
| XLogP | 4.33 |
| TPSA | 193.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|