C22H17BrN8O3 — CID 136717072
2-bromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 136717072) has the molecular formula C22H17BrN8O3 and a molecular weight of 521.34 g/mol. Its IUPAC name is 2-bromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 136717072 |
| Molecular Formula | C22H17BrN8O3 |
| Molecular Weight | 521.34 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 2-bromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H17BrN8O3/c23-18-12-17(31(33)34)11-14(19(18)32)13-24-30-22-28-20(25-15-7-3-1-4-8-15)27-21(29-22)26-16-9-5-2-6-10-16/h1-13,32H,(H3,25,26,27,28,29,30)/b24-13- |
| InChIKey | GUHAHPLRZBASQI-CFRMEGHHSA-N |
| XLogP | 5.18 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|