C19H19BrN8O3 — CID 5182403
2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-4-nitrophenol (PubChem CID 5182403) has the molecular formula C19H19BrN8O3 and a molecular weight of 487.32 g/mol. Its IUPAC name is 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-4-nitrophenol.
| Compound Name | 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
|---|---|
| PubChem CID | 5182403 |
| Molecular Formula | C19H19BrN8O3 |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 2-[[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(NN=Cc2cc([N+](=O)[O-])cc(Br)c2O)n1 |
| InChI | InChI=1S/C19H19BrN8O3/c1-27(2)19-24-17(21-10-12-6-4-3-5-7-12)23-18(25-19)26-22-11-13-8-14(28(30)31)9-15(20)16(13)29/h3-9,11,29H,10H2,1-2H3,(H2,21,23,24,25,26) |
| InChIKey | UKOVZBIAERWVFW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|