C20H22BrN7O2 — CID 137088966
4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenol (PubChem CID 137088966) has the molecular formula C20H22BrN7O2 and a molecular weight of 472.35 g/mol. Its IUPAC name is 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 137088966 |
| Molecular Formula | C20H22BrN7O2 |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(/C=N\Nc2nc(NCc3ccccc3)nc(N(C)C)n2)cc(Br)c1O |
| InChI | InChI=1S/C20H22BrN7O2/c1-28(2)20-25-18(22-11-13-7-5-4-6-8-13)24-19(26-20)27-23-12-14-9-15(21)17(29)16(10-14)30-3/h4-10,12,29H,11H2,1-3H3,(H2,22,24,25,26,27)/b23-12- |
| InChIKey | OWAKBSNAUZRAJT-FMCGGJTJSA-N |
| XLogP | 3.47 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|