C19H20BrN7O2 — CID 135909213
4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromobenzene-1,3-diol (PubChem CID 135909213) has the molecular formula C19H20BrN7O2 and a molecular weight of 458.32 g/mol. Its IUPAC name is 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromobenzene-1,3-diol.
| Compound Name | 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromobenzene-1,3-diol |
|---|---|
| PubChem CID | 135909213 |
| Molecular Formula | C19H20BrN7O2 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-[(Z)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromobenzene-1,3-diol |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(N/N=C\c2cc(Br)c(O)cc2O)n1 |
| InChI | InChI=1S/C19H20BrN7O2/c1-27(2)19-24-17(21-10-12-6-4-3-5-7-12)23-18(25-19)26-22-11-13-8-14(20)16(29)9-15(13)28/h3-9,11,28-29H,10H2,1-2H3,(H2,21,23,24,25,26)/b22-11- |
| InChIKey | WCWSXDTXOZZTMF-JJFYIABZSA-N |
| XLogP | 3.17 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|