C29H24N8O2 — CID 136898159
2-[(Z)-[[4-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 136898159) has the molecular formula C29H24N8O2 and a molecular weight of 516.57 g/mol. Its IUPAC name is 2-[(Z)-[[4-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(Z)-[[4-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136898159 |
| Molecular Formula | C29H24N8O2 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-[(Z)-[[4-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccccc1/C=N\Nc1nc(N/N=C\c2ccccc2O)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H24N8O2/c38-25-17-9-7-11-21(25)19-30-35-27-32-28(36-31-20-22-12-8-10-18-26(22)39)34-29(33-27)37(23-13-3-1-4-14-23)24-15-5-2-6-16-24/h1-20,38-39H,(H2,32,33,34,35,36)/b30-19-,31-20- |
| InChIKey | YIYSHMXLISGXNO-UTPVQHNTSA-N |
| XLogP | 5.64 |
| TPSA | 131.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|