C33H32N8O4 — CID 3965137
6-N-[(2,3-dimethoxyphenyl)methylideneamino]-4-N-[(2,4-dimethoxyphenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 3965137) has the molecular formula C33H32N8O4 and a molecular weight of 604.67 g/mol. Its IUPAC name is 6-N-[(2,3-dimethoxyphenyl)methylideneamino]-4-N-[(2,4-dimethoxyphenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[(2,3-dimethoxyphenyl)methylideneamino]-4-N-[(2,4-dimethoxyphenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3965137 |
| Molecular Formula | C33H32N8O4 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 6-N-[(2,3-dimethoxyphenyl)methylideneamino]-4-N-[(2,4-dimethoxyphenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(C=NNc2nc(NN=Cc3cccc(OC)c3OC)nc(N(c3ccccc3)c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C33H32N8O4/c1-42-27-19-18-23(29(20-27)44-3)21-34-39-31-36-32(40-35-22-24-12-11-17-28(43-2)30(24)45-4)38-33(37-31)41(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-22H,1-4H3,(H2,36,37,38,39,40) |
| InChIKey | RGMKFRDXCVJQFW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|