C19H22N2O6 — CID 2592580
N-[(2,4-dimethoxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 2592580) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2592580 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O6/c1-23-14-7-6-12(15(10-14)24-2)11-20-21-19(22)13-8-16(25-3)18(27-5)17(9-13)26-4/h6-11H,1-5H3,(H,21,22) |
| InChIKey | XQVGLPRERKXJCV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|