C24H23N3O5 — CID 6262653
N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 6262653) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 6262653 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-4-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)N/N=C\c3ccc(OC)cc3OC)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O5/c1-30-20-11-6-16(7-12-20)23(28)26-19-9-4-17(5-10-19)24(29)27-25-15-18-8-13-21(31-2)14-22(18)32-3/h4-15H,1-3H3,(H,26,28)(H,27,29)/b25-15- |
| InChIKey | IROXJUMMUBTGCO-MYYYXRDXSA-N |
| XLogP | 3.73 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|