C21H22N2O8 — CID 139086784
3,4,5-trimethoxy-N-[(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]benzamide;hydrate (PubChem CID 139086784) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]benzamide;hydrate.
| Compound Name | 3,4,5-trimethoxy-N-[(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]benzamide;hydrate |
|---|---|
| PubChem CID | 139086784 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]benzamide;hydrate |
| SMILES | COc1ccc2occ(/C=N/NC(=O)c3cc(OC)c(OC)c(OC)c3)c(=O)c2c1.O |
| InChI | InChI=1S/C21H20N2O7.H2O/c1-26-14-5-6-16-15(9-14)19(24)13(11-30-16)10-22-23-21(25)12-7-17(27-2)20(29-4)18(8-12)28-3;/h5-11H,1-4H3,(H,23,25);1H2/b22-10+; |
| InChIKey | CMAXGCJLZNADPX-UAONINCZSA-N |
| XLogP | 1.77 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|