C12H11N3O4 — CID 6878010
[(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]urea (PubChem CID 6878010) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is [(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]urea.
| Compound Name | [(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 6878010 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | [(E)-(6-methoxy-4-oxochromen-3-yl)methylideneamino]urea |
| SMILES | COc1ccc2occ(/C=N/NC(N)=O)c(=O)c2c1 |
| InChI | InChI=1S/C12H11N3O4/c1-18-8-2-3-10-9(4-8)11(16)7(6-19-10)5-14-15-12(13)17/h2-6H,1H3,(H3,13,15,17)/b14-5+ |
| InChIKey | QYJCARBLUOAXAP-LHHJGKSTSA-N |
| XLogP | 0.80 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|