C11H8ClN3O3 — CID 6887527
[(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]urea (PubChem CID 6887527) has the molecular formula C11H8ClN3O3 and a molecular weight of 265.66 g/mol. Its IUPAC name is [(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]urea.
| Compound Name | [(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 6887527 |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | [(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1coc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C11H8ClN3O3/c12-7-1-2-9-8(3-7)10(16)6(5-18-9)4-14-15-11(13)17/h1-5H,(H3,13,15,17)/b14-4+ |
| InChIKey | UILWRAYNVZWATQ-LNKIKWGQSA-N |
| XLogP | 1.45 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|