C19H12Cl3N3O4 — CID 3278227
3,4-dichloro-N-[2-[2-[(6-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 3278227) has the molecular formula C19H12Cl3N3O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[2-[(6-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[2-[(6-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3278227 |
| Molecular Formula | C19H12Cl3N3O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 3,4-dichloro-N-[2-[2-[(6-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NN=Cc1coc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H12Cl3N3O4/c20-12-2-4-16-13(6-12)18(27)11(9-29-16)7-24-25-17(26)8-23-19(28)10-1-3-14(21)15(22)5-10/h1-7,9H,8H2,(H,23,28)(H,25,26) |
| InChIKey | QPGJGURDRRHRPO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|