C19H13Cl2N3O4 — CID 4227337
N-(3-chloro-2-methylphenyl)-N'-[(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide (PubChem CID 4227337) has the molecular formula C19H13Cl2N3O4 and a molecular weight of 418.24 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4227337 |
| Molecular Formula | C19H13Cl2N3O4 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(6-chloro-4-oxochromen-3-yl)methylideneamino]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NN=Cc1coc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H13Cl2N3O4/c1-10-14(21)3-2-4-15(10)23-18(26)19(27)24-22-8-11-9-28-16-6-5-12(20)7-13(16)17(11)25/h2-9H,1H3,(H,23,26)(H,24,27) |
| InChIKey | KTRAPOPKRYFRIZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|