C23H16BrCl2N3O4 — CID 45055255
[4-bromo-2-[(E)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 45055255) has the molecular formula C23H16BrCl2N3O4 and a molecular weight of 549.21 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[(E)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 45055255 |
| Molecular Formula | C23H16BrCl2N3O4 |
| Molecular Weight | 549.21 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | [4-bromo-2-[(E)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)N/N=C/c1cc(Br)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16BrCl2N3O4/c1-13-18(26)3-2-4-19(13)28-21(30)22(31)29-27-12-15-11-16(24)7-10-20(15)33-23(32)14-5-8-17(25)9-6-14/h2-12H,1H3,(H,28,30)(H,29,31)/b27-12+ |
| InChIKey | FESACVJUYXPYCE-KKMKTNMSSA-N |
| XLogP | 5.37 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.21 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|