C25H21BrClN3O6 — CID 6271852
[4-bromo-2-[(Z)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 6271852) has the molecular formula C25H21BrClN3O6 and a molecular weight of 574.82 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6271852 |
| Molecular Formula | C25H21BrClN3O6 |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-(3-chloro-2-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2C)cc1OC |
| InChI | InChI=1S/C25H21BrClN3O6/c1-14-18(27)5-4-6-19(14)29-23(31)24(32)30-28-13-16-11-17(26)8-10-20(16)36-25(33)15-7-9-21(34-2)22(12-15)35-3/h4-13H,1-3H3,(H,29,31)(H,30,32)/b28-13- |
| InChIKey | HQLQSHLWTANEOX-QDTIIGTASA-N |
| XLogP | 4.74 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|