C19H15N3O5 — CID 4563866
N-(2-methoxyphenyl)-N'-[(4-oxochromen-3-yl)methylideneamino]oxamide (PubChem CID 4563866) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-N'-[(4-oxochromen-3-yl)methylideneamino]oxamide.
| Compound Name | N-(2-methoxyphenyl)-N'-[(4-oxochromen-3-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4563866 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(2-methoxyphenyl)-N'-[(4-oxochromen-3-yl)methylideneamino]oxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)NN=Cc1coc2ccccc2c1=O |
| InChI | InChI=1S/C19H15N3O5/c1-26-16-9-5-3-7-14(16)21-18(24)19(25)22-20-10-12-11-27-15-8-4-2-6-13(15)17(12)23/h2-11H,1H3,(H,21,24)(H,22,25) |
| InChIKey | DPVKQTOUWNXKNP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|