C16H14ClN3O4 — CID 136891004
N-(3-chloro-2-methylphenyl)-N'-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]oxamide (PubChem CID 136891004) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 136891004 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)N/N=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14ClN3O4/c1-9-12(17)3-2-4-13(9)19-15(23)16(24)20-18-8-10-5-6-11(21)7-14(10)22/h2-8,21-22H,1H3,(H,19,23)(H,20,24)/b18-8- |
| InChIKey | VEOOTAASGVUCBX-LSCVHKIXSA-N |
| XLogP | 2.15 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|