C15H12FN3O4 — CID 135684849
N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)oxamide (PubChem CID 135684849) has the molecular formula C15H12FN3O4 and a molecular weight of 317.28 g/mol. Its IUPAC name is N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 135684849 |
| Molecular Formula | C15H12FN3O4 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N'-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-N-(4-fluorophenyl)oxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FN3O4/c16-10-2-4-11(5-3-10)18-14(22)15(23)19-17-8-9-1-6-12(20)7-13(9)21/h1-8,20-21H,(H,18,22)(H,19,23)/b17-8+ |
| InChIKey | OOVFSBMDFHKVGT-CAOOACKPSA-N |
| XLogP | 1.33 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|