C17H16N4O6 — CID 135648812
N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]propanediamide (PubChem CID 135648812) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]propanediamide.
| Compound Name | N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 135648812 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)N/N=C/c1ccc(O)cc1O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C17H16N4O6/c22-12-3-1-10(14(24)5-12)8-18-20-16(26)7-17(27)21-19-9-11-2-4-13(23)6-15(11)25/h1-6,8-9,22-25H,7H2,(H,20,26)(H,21,27)/b18-8+,19-9+ |
| InChIKey | FMNQACVNDJZEFA-GCBPPVMSSA-N |
| XLogP | 0.50 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|