C12H14N2O3 — CID 4531910
N-[(2,4-dihydroxyphenyl)methylideneamino]-2-methylbut-2-enamide (PubChem CID 4531910) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methylideneamino]-2-methylbut-2-enamide.
| Compound Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 4531910 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-methylbut-2-enamide |
| SMILES | CC=C(C)C(=O)NN=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C12H14N2O3/c1-3-8(2)12(17)14-13-7-9-4-5-10(15)6-11(9)16/h3-7,15-16H,1-2H3,(H,14,17) |
| InChIKey | OUYUXAASAYULAM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|