C23H18Cl3N3O3 — CID 4105886
N-(3-chloro-2-methylphenyl)-N'-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 4105886) has the molecular formula C23H18Cl3N3O3 and a molecular weight of 490.77 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 4105886 |
| Molecular Formula | C23H18Cl3N3O3 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)NN=Cc1cccc(OCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl3N3O3/c1-14-18(24)7-4-10-21(14)28-22(30)23(31)29-27-12-15-5-2-6-16(11-15)32-13-17-19(25)8-3-9-20(17)26/h2-12H,13H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | AZKWGNDQRYUPAB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|