C24H19BrCl3N3O4 — CID 19659955
N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(3-chloro-2-methylphenyl)oxamide (PubChem CID 19659955) has the molecular formula C24H19BrCl3N3O4 and a molecular weight of 599.70 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(3-chloro-2-methylphenyl)oxamide.
| Compound Name | N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(3-chloro-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 19659955 |
| Molecular Formula | C24H19BrCl3N3O4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 596.96 |
| IUPAC Name | N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(3-chloro-2-methylphenyl)oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2cccc(Cl)c2C)cc(Br)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19BrCl3N3O4/c1-13-17(26)5-4-8-20(13)30-23(32)24(33)31-29-11-14-9-16(25)22(21(10-14)34-2)35-12-15-18(27)6-3-7-19(15)28/h3-11H,12H2,1-2H3,(H,30,32)(H,31,33)/b29-11+ |
| InChIKey | YUWPUXOULNOFDG-VPUKRXIYSA-N |
| XLogP | 6.39 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|