C17H15BrCl2N2O4 — CID 5009663
methyl N-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate (PubChem CID 5009663) has the molecular formula C17H15BrCl2N2O4 and a molecular weight of 462.13 g/mol. Its IUPAC name is methyl N-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 5009663 |
| Molecular Formula | C17H15BrCl2N2O4 |
| Molecular Weight | 462.13 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | methyl N-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1cc(Br)c(OCc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C17H15BrCl2N2O4/c1-24-15-7-10(8-21-22-17(23)25-2)6-12(18)16(15)26-9-11-13(19)4-3-5-14(11)20/h3-8H,9H2,1-2H3,(H,22,23) |
| InChIKey | VUNJNQKVMPZTJK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.13 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|